153182-42-4 Usage
Description
(4R,5S,6S,7R)-4,7-dibenzyl-1,3-bis[(3-fluorophenyl)methyl]-5,6-dihydroxy-1,3-diazepan-2-one is a complex chemical compound featuring a diazepan ring with two benzyl groups and two (3-fluorophenyl)methyl groups attached. (4R,5S,6S,7R)-4,7-dibenzyl-1,3-bis[(3-fluorophenyl)methyl]-5,6-dihydro xy-1,3-diazepan-2-one has a chiral center with a configuration of 4R, 5S, 6S, and 7R, resulting in four different stereoisomers. Its molecular formula is C33H34F2N2O2, and it holds potential applications in pharmacology and medicinal chemistry due to its unique structure and the presence of fluorine atoms, which can provide specific properties and interactions in biological systems.
Uses
Used in Pharmaceutical Industry:
(4R,5S,6S,7R)-4,7-dibenzyl-1,3-bis[(3-fluorophenyl)methyl]-5,6-dihydroxy-1,3-diazepan-2-one is used as a potential pharmaceutical candidate for various applications due to its unique structure and the presence of fluorine atoms, which can impart specific properties and interactions in biological systems.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, (4R,5S,6S,7R)-4,7-dibenzyl-1,3-bis[(3-fluorophenyl)methyl]-5,6-dihydroxy-1,3-diazepan-2-one is used for the development of new drugs and therapeutic agents, taking advantage of its complex structure and chiral centers to target specific biological pathways or receptors.
Further research and analysis are required to fully understand the potential uses and effects of (4R,5S,6S,7R)-4,7-dibenzyl-1,3-bis[(3-fluorophenyl)methyl]-5,6-dihydroxy-1,3-diazepan-2-one in various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 153182-42-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,3,1,8 and 2 respectively; the second part has 2 digits, 4 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 153182-42:
(8*1)+(7*5)+(6*3)+(5*1)+(4*8)+(3*2)+(2*4)+(1*2)=114
114 % 10 = 4
So 153182-42-4 is a valid CAS Registry Number.
InChI:InChI=1/C33H32F2N2O3/c34-27-15-7-13-25(17-27)21-36-29(19-23-9-3-1-4-10-23)31(38)32(39)30(20-24-11-5-2-6-12-24)37(33(36)40)22-26-14-8-16-28(35)18-26/h1-18,29-32,38-39H,19-22H2/t29-,30-,31+,32+/m1/s1
153182-42-4Relevant articles and documents
Cyclic HIV protease inhibitors: Synthesis, conformational analysis, P2/P2' structure-activity relationship, and molecular recognition of cyclic ureas
Lam, Patrick Y. S.,Ru, Yu,Jadhav, Prabhakar K.,Aldrich, Paul E.,DeLucca, George V.,Eyermann, Charles J.,Chang, Chong-Hwan,Emmett, George,Holler, Edward R.,Daneker, Wayne F.,Li, Liangzhu,Confalone, Pat N.,McHugh, Robert J.,Han, Qi,Li, Renhua,Markwalder, Jay A.,Seitz, Steven P.,Sharpe, Thomas R.,Bacheler, Lee T.,Rayner, Marlene M.,Klabe, Ronald M.,Shum, Linyee,Winslow, Dean L.,Kornhauser, David M.,Jackson, David A.,Erickson-Viitanen, Susan,Hodge, C. Nicholas
, p. 3514 - 3525 (2007/10/03)
High-resolution X-ray structures of the complexes of HIV-1 protease (HIV-1PR) with peptidomimetic inhibitors reveal the presence of a structural water molecule which is hydrogen bonded to both the mobile flaps of the enzyme and the two carbonyls flanking