153182-60-6 Usage
Description
(4R,5S,6S,7R)-4,7-dibenzyl-5,6-dihydroxy-1,3-bis(2-methoxyethyl)-1,3-diazepan-2-one is a complex organic compound characterized by its diazepane ring structure, featuring two benzyl groups, two hydroxy groups, and two 2-methoxyethyl groups. The specific stereochemistry and arrangement of these functional groups endow the molecule with unique properties, making it a promising candidate for pharmaceutical applications and organic synthesis.
Uses
Used in Pharmaceutical Applications:
(4R,5S,6S,7R)-4,7-dibenzyl-5,6-dihydroxy-1,3-bis(2-methoxyethyl)-1,3-diazepan-2-one is used as a pharmaceutical compound for its potential therapeutic effects. The unique combination of functional groups and stereochemistry allows for the possibility of targeting specific biological pathways or receptors, which could be beneficial in the development of new drugs for various medical conditions.
Used in Organic Synthesis:
In the field of organic synthesis, (4R,5S,6S,7R)-4,7-dibenzyl-5,6-dihydroxy-1,3-bis(2-methoxyethyl)-1,3-diazepan-2-one can be used as a key intermediate or building block for the synthesis of more complex molecules. Its unique structure and functional groups can be exploited to create novel compounds with potential applications in various industries, including pharmaceuticals, agrochemicals, and materials science.
Used in Medicinal Chemistry Research:
(4R,5S,6S,7R)-4,7-dibenzyl-5,6-dihydroxy-1,3-bis(2-methoxyethyl)-1,3-d iazepan-2-one (4R,5S,6S,7R)-4,7-dibenzyl-5,6-dihydroxy-1,3-bis(2-methoxyethyl)-1,3-diazepan-2-one is used as a subject of study in medicinal chemistry research. Its specific stereochemistry and functional groups make it an interesting molecule for further investigation, potentially leading to the discovery of new drug candidates or a better understanding of molecular interactions at the biological level.
Check Digit Verification of cas no
The CAS Registry Mumber 153182-60-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,3,1,8 and 2 respectively; the second part has 2 digits, 6 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 153182-60:
(8*1)+(7*5)+(6*3)+(5*1)+(4*8)+(3*2)+(2*6)+(1*0)=116
116 % 10 = 6
So 153182-60-6 is a valid CAS Registry Number.
InChI:InChI=1/C25H34N2O5/c1-31-15-13-26-21(17-19-9-5-3-6-10-19)23(28)24(29)22(18-20-11-7-4-8-12-20)27(25(26)30)14-16-32-2/h3-12,21-24,28-29H,13-18H2,1-2H3/t21-,22-,23+,24+/m1/s1
153182-60-6Relevant articles and documents
Cyclic HIV protease inhibitors: Synthesis, conformational analysis, P2/P2' structure-activity relationship, and molecular recognition of cyclic ureas
Lam, Patrick Y. S.,Ru, Yu,Jadhav, Prabhakar K.,Aldrich, Paul E.,DeLucca, George V.,Eyermann, Charles J.,Chang, Chong-Hwan,Emmett, George,Holler, Edward R.,Daneker, Wayne F.,Li, Liangzhu,Confalone, Pat N.,McHugh, Robert J.,Han, Qi,Li, Renhua,Markwalder, Jay A.,Seitz, Steven P.,Sharpe, Thomas R.,Bacheler, Lee T.,Rayner, Marlene M.,Klabe, Ronald M.,Shum, Linyee,Winslow, Dean L.,Kornhauser, David M.,Jackson, David A.,Erickson-Viitanen, Susan,Hodge, C. Nicholas
, p. 3514 - 3525 (2007/10/03)
High-resolution X-ray structures of the complexes of HIV-1 protease (HIV-1PR) with peptidomimetic inhibitors reveal the presence of a structural water molecule which is hydrogen bonded to both the mobile flaps of the enzyme and the two carbonyls flanking