153773-82-1 Usage
Description
1-Azabicyclo(3.2.0)hept-2-ene-2-carboxylic acid, 3-(((3S,5S)-5-(((3-carboxyphenyl)amino)carbonyl)-3-pyrrolidinyl)thio)-6-((1R)-1-hydroxyethyl)-4-methyl-7-oxo-, monosodium salt, (4R,5S,6S)is a complex organic compound with a unique molecular structure. It is characterized by its bicyclic ring system, multiple functional groups, and chiral centers. 1-Azabicyclo(3.2.0)hept-2-ene-2-carboxylic acid, 3-(((3S,5S)-5-(((3-ca rboxyphenyl)amino)carbonyl)-3-pyrrolidinyl)thio)-6-((1R)-1-hydroxyethy l)-4-methyl-7-oxo-, monosodium salt, (4R,5S,6S)has potential applications in various fields due to its structural diversity and functional properties.
Uses
1. Used in Pharmaceutical Industry:
1-Azabicyclo(3.2.0)hept-2-ene-2-carboxylic acid, 3-(((3S,5S)-5-(((3-carboxyphenyl)amino)carbonyl)-3-pyrrolidinyl)thio)-6-((1R)-1-hydroxyethyl)-4-methyl-7-oxo-, monosodium salt, (4R,5S,6S)is used as an active pharmaceutical ingredient for the treatment of various infections. Its complex structure allows it to target specific enzymes or receptors in bacteria, making it effective against a range of pathogens.
2. Used in Chemical Research:
1-Azabicyclo(3.2.0)hept-2-ene-2-carboxylic acid, 3-(((3S,5S)-5-(((3-ca rboxyphenyl)amino)carbonyl)-3-pyrrolidinyl)thio)-6-((1R)-1-hydroxyethy l)-4-methyl-7-oxo-, monosodium salt, (4R,5S,6S)is also utilized in chemical research as a starting material or intermediate for the synthesis of other complex organic molecules. Its unique structure and functional groups make it a valuable tool for exploring new chemical reactions and developing novel compounds with potential applications in various industries.
3. Used in Material Science:
Due to its structural properties, 1-Azabicyclo(3.2.0)hept-2-ene-2-carboxylic acid, 3-(((3S,5S)-5-(((3-carboxyphenyl)amino)carbonyl)-3-pyrrolidinyl)thio)-6-((1R)-1-hydroxyethyl)-4-methyl-7-oxo-, monosodium salt, (4R,5S,6S)can be used in the development of new materials with specific properties, such as improved mechanical strength, thermal stability, or chemical resistance.
4. Used in Environmental Applications:
The compound may also find applications in environmental science, where it could be used to develop new methods for pollutant detection, removal, or degradation. Its functional groups and structural features could be exploited to create selective binding sites for pollutants or to catalyze specific environmental processes.
Biochem/physiol Actions
Ertapenem is a broad spectrum carbopenem antibiotic. Ertapenem is active against both gram-positive and gram-negative bacteria. Ertapenem shows an extended duration of action in vivo due to its reversible binding to serum protein.
Check Digit Verification of cas no
The CAS Registry Mumber 153773-82-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,3,7,7 and 3 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 153773-82:
(8*1)+(7*5)+(6*3)+(5*7)+(4*7)+(3*3)+(2*8)+(1*2)=151
151 % 10 = 1
So 153773-82-1 is a valid CAS Registry Number.
InChI:InChI=1/C22H25N3O7S.Na/c1-9-16-15(10(2)26)20(28)25(16)17(22(31)32)18(9)33-13-7-14(23-8-13)19(27)24-12-5-3-4-11(6-12)21(29)30;/h3-6,9-10,13-16,23,26H,7-8H2,1-2H3,(H,24,27)(H,29,30)(H,31,32);/q;+1/p-1/t9-,10-,13+,14+,15-,16-;/m1./s1
153773-82-1Relevant articles and documents
A double protection of the border he south cultivates the crystal and its preparation process
-
Paragraph 0067; 0068, (2017/08/25)
The present invention relates to the technical field of pharmaceutical intermediate synthesis, particularly to the technical field of a crystal form and a preparation process of an ertapenem intermediate, particularly to a crystal form and a preparation process of double-protection ertapenem, wherein the characteristic peaks of the double-protection group ertapenem crystal form exist when the 2[theta] angle is 5.7+/-0.2 DEG, 8.6+/-0.2 DEG, 12.8+/-0.2 DEG, 14.3+/-0.2 DEG, 15.8+/-0.2 DEG, 16.7+/-0.2 DEG, and 18.0+/-0.2 DEG.