154458-86-3 Usage
Explanation
The compound is composed of 10 carbon atoms, 6 hydrogen atoms, 2 chlorine atoms, and 1 nitrogen atom.
Explanation
The core structure of the compound is a pyrrole, which is a five-membered ring containing one nitrogen atom and four carbon atoms.
Explanation
The pyrrole ring is substituted with a 3,5-dichlorophenyl group, which consists of a benzene ring with two chlorine atoms at the 3rd and 5th positions.
Explanation
The compound appears as a pale yellow solid at room temperature.
Explanation
The molecular weight of the compound is the sum of the atomic weights of all the atoms in the molecule, which is 204.07 grams per mole.
Explanation
The compound is utilized in research and chemical synthesis due to its unique structure and properties, making it a potentially useful building block for the synthesis of various organic compounds.
Explanation
The compound's structure and chemical properties make it a useful tool for studying interactions with other molecules and exploring potential applications in the pharmaceutical and materials science fields.
Explanation
The compound's unique structure allows researchers to investigate how it interacts with other molecules, which can lead to a better understanding of its potential applications and properties.
Structure
Pyrrole derivative with a five-membered ring and a nitrogen atom
Substituents
3,5-Dichlorophenyl
Physical state
Pale yellow solid
Molecular weight
204.07 g/mol
Research and chemical synthesis
Used in research and chemical synthesis
Applications
Pharmaceutical and materials science fields
Interactions
Useful for studying interactions with other molecules
Check Digit Verification of cas no
The CAS Registry Mumber 154458-86-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,4,4,5 and 8 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 154458-86:
(8*1)+(7*5)+(6*4)+(5*4)+(4*5)+(3*8)+(2*8)+(1*6)=153
153 % 10 = 3
So 154458-86-3 is a valid CAS Registry Number.
InChI:InChI=1/C10H7Cl2N/c11-8-5-9(12)7-10(6-8)13-3-1-2-4-13/h1-7H
