1555-11-9 Usage
General Description
2-FLUORO-7,8,9,10-TETRAHYDRO-6H-CYCLOHEPTA[B]QUINOLINE-11-CARBOXYLIC ACID is a chemical compound with the molecular formula C15H16FNO2. It is a fluorinated derivative of cycloheptabenzofuran, and its structure includes a fluorine atom attached to a seven-membered ring. 2-FLUORO-7,8,9,10-TETRAHYDRO-6H-CYCLOHEPTA[B]QUINOLINE-11-CARBOXYLIC ACID is a carboxylic acid, which means it contains a carboxyl functional group (COOH). It may have potential applications in medicinal chemistry and drug development due to its unique structure and the presence of the fluorine atom, which can contribute to the molecule's bioavailability and pharmacokinetic properties. Further research and studies are needed to understand its potential uses and properties.
Check Digit Verification of cas no
The CAS Registry Mumber 1555-11-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,5,5 and 5 respectively; the second part has 2 digits, 1 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 1555-11:
(6*1)+(5*5)+(4*5)+(3*5)+(2*1)+(1*1)=69
69 % 10 = 9
So 1555-11-9 is a valid CAS Registry Number.
InChI:InChI=1/C15H14FNO2/c16-9-6-7-13-11(8-9)14(15(18)19)10-4-2-1-3-5-12(10)17-13/h6-8H,1-5H2,(H,18,19)
