156021-08-8 Usage
Description
4-Methyl-2,5-diphenylpyridine is an organic compound characterized by its unique molecular structure, featuring a pyridine ring with a methyl group at the 4th position and two phenyl groups attached at the 2nd and 5th positions. 4-Methyl-2,5-diphenylpyridine is known for its potential applications in various fields due to its distinct chemical properties.
Uses
Used in Light-Emitting Device Research:
4-Methyl-2,5-diphenylpyridine is used as a chemical compound in the field of light-emitting device research for its potential to enhance the performance and efficiency of these devices. Its unique structure and properties make it a valuable candidate for studying and developing new materials and technologies in this area.
Check Digit Verification of cas no
The CAS Registry Mumber 156021-08-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,6,0,2 and 1 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 156021-08:
(8*1)+(7*5)+(6*6)+(5*0)+(4*2)+(3*1)+(2*0)+(1*8)=98
98 % 10 = 8
So 156021-08-8 is a valid CAS Registry Number.
InChI:InChI=1/C18H15N/c1-14-12-18(16-10-6-3-7-11-16)19-13-17(14)15-8-4-2-5-9-15/h2-13H,1H3
