1570-86-1 Usage
Structure
Contains a cyclopropyl group with a p-tolylmethyl substituent
Type of compound
Carbonyl chloride derivative of cyclopropane
Applications
Primarily used as an intermediate in the synthesis of pharmaceuticals and agrochemicals
Reactivity
Reacts with various nucleophiles to form a wide range of cyclopropane carboxylic acid derivatives
Importance in chemistry
Has applications in medicinal chemistry and material science, and has been studied for its potential as a building block in the synthesis of bioactive molecules
Safety precautions
Volatile and reactive compound, requires careful handling to prevent irritation and harm
Check Digit Verification of cas no
The CAS Registry Mumber 1570-86-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,5,7 and 0 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 1570-86:
(6*1)+(5*5)+(4*7)+(3*0)+(2*8)+(1*6)=81
81 % 10 = 1
So 1570-86-1 is a valid CAS Registry Number.
InChI:InChI=1/C12H13ClO/c1-9-2-4-10(5-3-9)8-12(6-7-12)11(13)14/h2-5H,6-8H2,1H3
