1571-65-9 Usage
General Description
3-Amino-4-hydroxybenzoic acid hydrochloride is a chemical compound with the molecular formula C7H8ClNO3. It is a derivative of 4-hydroxybenzoic acid, and it contains an amino group and a hydroxyl group attached to the benzene ring. 3-Amino-4-hydroxybenzoic acid hydrochloride is commonly used in the field of organic chemistry and biochemistry as a reagent or intermediate in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals. It also has potential applications in the development of new drugs and medical treatments due to its biological activities. Additionally, as a hydrochloride salt, it is more stable and water-soluble, making it easier to handle and use in various chemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 1571-65-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,5,7 and 1 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 1571-65:
(6*1)+(5*5)+(4*7)+(3*1)+(2*6)+(1*5)=79
79 % 10 = 9
So 1571-65-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H7NO3.ClH/c8-5-3-4(7(10)11)1-2-6(5)9;/h1-3,9H,8H2,(H,10,11);1H
1571-65-9Relevant articles and documents
2 - (methylthio) benzo [d] oxazole-5-carboxylic acid and its use
-
Paragraph 0025; 0030-0032, (2017/03/08)
The invention discloses a 2-(methylthio)benzo[d]oxazolyl-5-carboxylic acid and application thereof. The product is prepared by the following steps: synthesizing methyl 3-nitro-4-hydroxybenzoate; synthesizing 3-amino-4-hydroxybenzoic acid; synthesizing 2-sulfhydrylbenzo[d]oxazolyl-5-carboxylic acid; and synthesizing the 2-(methylthio)benzo[d]oxazolyl-5-carboxylic acid. The test result indicates that the electrochemiluminescence property of the 2-(methylthio)benzo[d]oxazolyl-5-carboxylic acid is very stable within the potential range of (-2-0)V and has obviously higher luminescent intensity in a water phase than an organic phase.
