15776-59-7 Usage
Description
3-[2-(DIETHYLAMINO)ETHYL]-7-HYDROXY-4-METHYLCOUMARIN HYDROCHLORIDE is a chemical compound with the molecular formula C18H24ClNO3. It is characterized by its hydroxyl and methyl groups, which contribute to its unique chemical properties and potential applications.
Uses
Used in Pharmaceutical Industry:
3-[2-(DIETHYLAMINO)ETHYL]-7-HYDROXY-4-METHYLCOUMARIN HYDROCHLORIDE is used as an intermediate compound for the synthesis of novel metal-free and zinc phthalocyanines. These phthalocyanines have potential applications in various fields, including medicine, due to their unique chemical and physical properties.
Used in Chemical Synthesis:
3-[2-(DIETHYLAMINO)ETHYL]-7-HYDROXY-4-METHYLCOUMARIN HYDROCHLORIDE is used as a key component in the synthesis of 3-(2-diethylaminoethyl)-4-methyl-7-substituted coumarins. These coumarins exhibit antifungal activities against Botrytis cinerea, a common plant pathogen that causes significant damage to various crops. The compound's role in creating these antifungal agents highlights its potential in the agricultural and chemical industries.
Check Digit Verification of cas no
The CAS Registry Mumber 15776-59-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,5,7,7 and 6 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 15776-59:
(7*1)+(6*5)+(5*7)+(4*7)+(3*6)+(2*5)+(1*9)=137
137 % 10 = 7
So 15776-59-7 is a valid CAS Registry Number.
InChI:InChI=1/C16H21NO3.ClH/c1-4-17(5-2)9-8-14-11(3)13-7-6-12(18)10-15(13)20-16(14)19;/h6-7,10,18H,4-5,8-9H2,1-3H3;1H
