15849-58-8 Usage
1H-Indol-3-yl
Refers to the presence of an indole group (a benzene ring fused to a five-membered nitrogen-containing ring) connected to the rest of the molecule at the 3-position (third carbon atom in the chain).
3-(4-Methoxyphenyl)oxiran-2-yl
Indicates the presence of an oxirane group (a three-membered oxygen-containing ring) at the 3-position and a 4-methoxyphenyl group (a phenyl group with a methoxy substituent at the 4-position) attached to the oxirane ring.
Methanone
Identifies the molecule as a ketone, which means it contains a carbonyl group (C=O) bonded to two carbon atoms.
Methoxy (CH3O) group
A methoxy group is a methyl group (CH3) bonded to an oxygen atom (O). It is a substituent that can influence the chemical properties and reactivity of the molecule.
Phenyl (C6H5) group
A phenyl group is a six-carbon ring with alternating single and double bonds, and it is a part of the 4-methoxyphenyl substituent in this molecule. It can also affect the chemical properties and reactivity of the molecule.
Complex organic compound
The molecule is a complex organic compound, meaning it has a large and intricate structure composed of multiple different functional groups.
Potential applications
While the exact uses and applications of this compound are not immediately clear, it may have significance in organic synthesis, medicinal chemistry, or related fields due to its structural diversity and complex nature.
Check Digit Verification of cas no
The CAS Registry Mumber 15849-58-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,5,8,4 and 9 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 15849-58:
(7*1)+(6*5)+(5*8)+(4*4)+(3*9)+(2*5)+(1*8)=138
138 % 10 = 8
So 15849-58-8 is a valid CAS Registry Number.
InChI:InChI=1/C18H15NO3/c1-21-12-8-6-11(7-9-12)17-18(22-17)16(20)14-10-19-15-5-3-2-4-13(14)15/h2-10,17-19H,1H3