15890-40-1 Usage
Description
CIS,CIS,TRANS-1,2,3-TRIMETHYLCYCLOPENTANE, also known as 1-cis-2-trans-3-Trimethylcyclopentane, is a versatile organic compound with a unique molecular structure. It is characterized by its three methyl groups attached to a cyclopentane ring, with one being in the cis position, another in the cis position, and the third in the trans position. CIS,CIS,TRANS-1,2,3-TRIMETHYLCYCLOPENTANE is known for its stability and reactivity, making it a valuable building block in the synthesis of various chemical compounds.
Uses
Used in Chemical Synthesis:
CIS,CIS,TRANS-1,2,3-TRIMETHYLCYCLOPENTANE is used as a building block for the synthesis of various chemical compounds. Its unique structure allows for the creation of a wide range of molecules with different properties and applications.
Used in the Petrochemical Industry:
CIS,CIS,TRANS-1,2,3-TRIMETHYLCYCLOPENTANE is used as a component of gasoline. Its presence in the fuel mixture contributes to the overall energy content and performance of the gasoline, making it a valuable addition to the petrochemical industry.
Check Digit Verification of cas no
The CAS Registry Mumber 15890-40-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,5,8,9 and 0 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 15890-40:
(7*1)+(6*5)+(5*8)+(4*9)+(3*0)+(2*4)+(1*0)=121
121 % 10 = 1
So 15890-40-1 is a valid CAS Registry Number.
InChI:InChI=1/C8H16/c1-6-4-5-7(2)8(6)3/h6-8H,4-5H2,1-3H3/t6-,7-/m1/s1
