15910-11-9 Usage
Description
TRANS,TRANS-1,4-DIACETOXY-1,3-BUTADIENE, also known as (1E,3E)-1,4-Diacetoxy-1,3-butadiene, is an organic compound that serves as a crucial intermediate in the synthesis of various compounds. It is characterized by its structural formula, which includes two acetoxy groups and a conjugated diene system, making it a versatile building block in organic chemistry.
Uses
Used in Organic Synthesis:
TRANS,TRANS-1,4-DIACETOXY-1,3-BUTADIENE is used as an intermediate in the synthesis of Conduritol D (C667000) for its ability to facilitate the formation of complex organic molecules. Conduritol D is a valuable compound in organic synthesis, which can be further utilized to create a wide range of chemical products.
Used in Pharmaceutical Industry:
TRANS,TRANS-1,4-DIACETOXY-1,3-BUTADIENE, through its role in synthesizing Conduritol D, contributes to the development of pharmaceutical compounds. Conduritol D has been found to be useful in the synthesis of various drugs, including those targeting diabetes and other health conditions. The compound's unique structure allows for the creation of novel drug candidates with potential therapeutic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 15910-11-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,5,9,1 and 0 respectively; the second part has 2 digits, 1 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 15910-11:
(7*1)+(6*5)+(5*9)+(4*1)+(3*0)+(2*1)+(1*1)=89
89 % 10 = 9
So 15910-11-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H10O4/c1-7(9)11-5-3-4-6-12-8(2)10/h3-6H,1-2H3/b5-3+,6-4+