16085-50-0 Usage
General Description
1,5-DIMETHYL-1H,5H-[1,2,4]TRIAZOLO[1,2-A][1,2,4]TRIAZOLE-3,7-DITHIOL is a chemical compound with the molecular formula C4H6N4S2. It is a heterocyclic compound containing both nitrogen and sulfur atoms in its structure. 1,5-DIMETHYL-1H,5H-[1,2,4]TRIAZOLO[1,2-A][1,2,4]TRIAZOLE-3,7-DITHIOL is used in chemical synthesis and research and is also a potential building block for the development of new materials. Its unique structure and properties make it a valuable tool for studies in the field of organic chemistry and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 16085-50-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,0,8 and 5 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 16085-50:
(7*1)+(6*6)+(5*0)+(4*8)+(3*5)+(2*5)+(1*0)=100
100 % 10 = 0
So 16085-50-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H10N4S2/c1-3-7-5(11)10-4(2)8-6(12)9(3)10/h3-4H,1-2H3,(H,7,11)(H,8,12)
Xi:Irritant;
