161928-84-3 Usage
Description
[(E)-3-(3,4-dimethoxyphenyl)prop-2-enyl] (Z)-2-[[(E)-2-methylbut-2-eno yl]oxymethyl]but-2-enoate is a complex ester compound characterized by its unique structure, which includes a prop-2-enyl group with a benzene ring featuring two methoxy groups and an oxymethylbut-2-enoate group with a methylbut-2-enoate unit attached to an oxymethyl group. The presence of both E and Z stereoisomers suggests a geometric isomerism, adding to the compound's complexity. This intricate arrangement of aromatic and aliphatic functional groups may endow the molecule with a wide range of chemical and biological properties.
Uses
Used in Pharmaceutical Industry:
[(E)-3-(3,4-dimethoxyphenyl)prop-2-enyl] (Z)-2-[[(E)-2-methylbut-2-eno yl]oxymethyl]but-2-enoate is used as a pharmaceutical compound for its potential therapeutic applications. The complex structure and functional groups of the molecule may allow it to interact with various biological targets, making it a candidate for the development of new drugs.
Used in Chemical Synthesis:
In the chemical industry, [(E)-3-(3,4-dimethoxyphenyl)prop-2-enyl] (Z)-2-[[(E)-2-methylbut-2-eno yl]oxymethyl]but-2-enoate can be used as a key intermediate in the synthesis of other complex organic molecules. Its unique structure and functional groups may facilitate the creation of novel compounds with specific properties for various applications.
Used in Material Science:
[(E)-3-(3,4-dimethoxyphenyl)prop-2-enyl] (Z)-2-[[(E)-2-methylbut-2-eno yl]oxymethyl]but-2-enoate's aromatic and aliphatic components may also make it suitable for use in material science, where it could be employed in the development of new materials with tailored properties, such as improved stability, reactivity, or biocompatibility.
Used in Research and Development:
Due to its complex structure and potential for diverse chemical and biological properties, [(E)-3-(3,4-dimethoxyphenyl)prop-2-enyl] (Z)-2-[[(E)-2-methylbut-2-eno yl]oxymethyl]but-2-enoate can be a valuable compound for research and development purposes. It may be used to study the effects of geometric isomerism on molecular properties and to explore new reaction pathways in organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 161928-84-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,6,1,9,2 and 8 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 161928-84:
(8*1)+(7*6)+(6*1)+(5*9)+(4*2)+(3*8)+(2*8)+(1*4)=153
153 % 10 = 3
So 161928-84-3 is a valid CAS Registry Number.
InChI:InChI=1/C21H26O6/c1-6-15(3)20(22)27-14-17(7-2)21(23)26-12-8-9-16-10-11-18(24-4)19(13-16)25-5/h6-11,13H,12,14H2,1-5H3/b9-8+,15-6+,17-7-