16238-56-5 Usage
Description
Benz(a)anthracene, 7-bromomethyl-12-methyl, is a member of the class of tetraphenes, specifically a tetraphene with hydrogens at positions 7 and 12 replaced by bromomethyl and methyl groups, respectively. It is characterized by its fine yellow crystal structure.
Uses
1. Used in Chemical Synthesis:
Benz(a)anthracene, 7-bromomethyl-12-methyl, is used as a key intermediate in the synthesis of various organic compounds, particularly those with potential applications in the pharmaceutical and chemical industries. Its unique structure allows for further functionalization and modification to create a wide range of products.
2. Used in Research and Development:
Due to its specific structural features, Benz(a)anthracene, 7-bromomethyl-12-methyl, is utilized in research and development for studying the properties and behavior of tetraphene derivatives. This can lead to the discovery of new compounds with potential applications in various fields.
3. Used in Analytical Chemistry:
Benz(a)anthracene, 7-bromomethyl-12-methyl, can be employed as a reference compound or standard in analytical chemistry for the calibration of instruments and the development of new analytical methods. Its distinct properties make it suitable for such applications.
4. Used in Material Science:
The unique structural features of Benz(a)anthracene, 7-bromomethyl-12-methyl, may also find applications in material science, where it could be used to develop new materials with specific properties, such as improved stability or enhanced reactivity.
Please note that the provided materials do not specify any direct applications for Benz(a)anthracene, 7-bromomethyl-12-methyl, in industries like anticancer applications or drug delivery systems. The uses listed above are inferred based on the general properties and characteristics of the compound.
Air & Water Reactions
Insoluble in water.
Reactivity Profile
Benz(a)anthracene, 7-bromomethyl-12-methyl. is sensitive to prolonged exposure to light.
Health Hazard
ACUTE/CHRONIC HAZARDS: When heated to decomposition Benz(a)anthracene, 7-bromomethyl-12-methyl. emits toxic fumes.
Fire Hazard
Flash point data are not available for Benz(a)anthracene, 7-bromomethyl-12-methyl., but Benz(a)anthracene, 7-bromomethyl-12-methyl. is probably combustible.
Check Digit Verification of cas no
The CAS Registry Mumber 16238-56-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,2,3 and 8 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 16238-56:
(7*1)+(6*6)+(5*2)+(4*3)+(3*8)+(2*5)+(1*6)=105
105 % 10 = 5
So 16238-56-5 is a valid CAS Registry Number.
InChI:InChI=1/C20H15Br/c1-13-15-7-4-5-9-17(15)19(12-21)18-11-10-14-6-2-3-8-16(14)20(13)18/h2-11H,12H2,1H3