163733-96-8 Usage
Description
3,4,5-Trifluoroaniline is a halogenated aniline derivative characterized by the presence of three fluorine atoms at the 3rd, 4th, and 5th positions on the benzene ring. It is synthesized from pentafluoroacetanilide through a catalytic hydrodefluorination process. This pale brown crystalline powder exhibits unique chemical properties that make it suitable for various applications in scientific research and industry.
Uses
Used in Pharmaceutical and Chemical Research:
3,4,5-Trifluoroaniline is utilized as a research compound for studying Cytochrome P450 2E1/2A6-selective inhibition on metabolic activation of dimethylnitrosamine in human liver microsomes. This application is crucial for understanding the metabolic pathways and potential drug interactions involving Cytochrome P450 enzymes, which play a significant role in drug metabolism and detoxification processes.
Used in Organic Synthesis:
As a halogenated aniline, 3,4,5-Trifluoroaniline serves as a valuable intermediate in the synthesis of various organic compounds, including pharmaceuticals, agrochemicals, and specialty chemicals. Its unique fluorinated structure allows for the development of novel molecules with improved properties, such as enhanced biological activity, selectivity, and stability.
Used in Material Science:
The distinctive chemical and physical properties of 3,4,5-Trifluoroaniline make it a potential candidate for the development of new materials with specific characteristics. For instance, it can be incorporated into polymers to create fluorinated materials with improved thermal stability, chemical resistance, and other desirable properties for various industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 163733-96-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,6,3,7,3 and 3 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 163733-96:
(8*1)+(7*6)+(6*3)+(5*7)+(4*3)+(3*3)+(2*9)+(1*6)=148
148 % 10 = 8
So 163733-96-8 is a valid CAS Registry Number.
InChI:InChI=1/C6H4F3N/c7-4-1-3(10)2-5(8)6(4)9/h1-2H,10H2
163733-96-8Relevant articles and documents
Synthesis method of 3, 4, 5-trifluorophenol
-
Paragraph 0038-0039; 0043-0044; 0048-0049; 0053-0054, (2019/03/28)
The invention discloses a synthesis method of 3, 4, 5-trifluorophenol. The synthesis method includes following steps: taking 3, 4, 5-trifluorobromobenzene as a raw material, adding a certain volume ofammonia water and cuprous complexing catalyst, allowing
The ionic liquid [bmim]Br as an alternative medium for the catalytic cleavage of aromatic C-F and C-Cl bonds
Prikhod'ko, Sergey A.,Adonin, Nicolay Yu.,Parmon, Valentin N.
experimental part, p. 2265 - 2268 (2010/05/18)
The potential of [bmim]Br as an alternative to aprotic dipolar solvents in nickel-catalyzed hydrodehalogenation reactions is demonstrated. Hydrodechlorination of pentafluorochlorobenzene proceeds under the action of zinc in aqueous [bmim]Br. Under the above conditions aromatic C-F bonds also undergo slow cleavage. The reaction is significantly accelerated in the presence of nickel complexes with 2,2′-bipyridine or 1,10-phenanthroline. In the case of pentafluoroacetanilide highly regioselective ortho-hydrodefluorination leading to the formation of 3,4,5-trifluoroacetanilide is observed.
4-(Phenylamino)-[1,4]dioxano[2,3-g]quinazoline derivatives and process for preparing the same
-
, (2008/06/13)
The present invention relates to 4-(phenylamino)-[1,4]dioxano[2,3-g]quinazoline derivatives which inhibit tyrosine kinase of epidermal growth factor receptor (EGFR), and pharmaceutically acceptable salts, hydrates and solvates thereof, and a process for preparing the same. Since 4-(phenylamino)-[1,4]dioxano[2,3-g]quinazoline derivatives of the invention have a high solubility in water and inhibit the activity of EGFR tyrosine kinase and the growth of cancer cells, they can be practically applied in the treatment of overproliferation-associated diseases such as cancer.
