16408-95-0 Usage
Description
Indeno[2,1-a]indene-5,10-dione is a chemical compound characterized by a molecular formula of C18H8O2. It features a polycyclic aromatic structure with two fused benzene rings and a ketone group. Indeno[2,1-a]indene-5,10-dione is recognized for its potential applications in various fields, including organic synthesis, materials science, and medicinal chemistry. However, it is also noted for its high reactivity and potential toxicity, necessitating careful handling and safety measures in both laboratory and industrial environments.
Uses
Used in Organic Synthesis:
Indeno[2,1-a]indene-5,10-dione serves as a valuable intermediate in organic synthesis, particularly for the production of dyes, pigments, and other organic compounds. Its unique structure and reactivity make it a versatile building block for creating a wide range of chemical products.
Used in Materials Science:
In the field of materials science, Indeno[2,1-a]indene-5,10-dione is utilized for its potential to contribute to the development of new materials with specific properties. Its aromatic and ketone functionalities can be exploited to engineer materials with tailored characteristics for various applications.
Used in Medicinal Chemistry:
Indeno[2,1-a]indene-5,10-dione has been studied for its potential applications in medicinal chemistry. Its chemical properties allow it to be a candidate for the development of new pharmaceutical compounds, particularly those targeting specific biological pathways or mechanisms.
Used in Dye and Pigment Production:
As a precursor for the production of dyes and pigments, Indeno[2,1-a]indene-5,10-dione is used in the chemical industry to create a variety of colorants for different applications, such as inks, paints, and plastics. Its ability to form stable and vibrant colors makes it a valuable component in these products.
Check Digit Verification of cas no
The CAS Registry Mumber 16408-95-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,4,0 and 8 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 16408-95:
(7*1)+(6*6)+(5*4)+(4*0)+(3*8)+(2*9)+(1*5)=110
110 % 10 = 0
So 16408-95-0 is a valid CAS Registry Number.
InChI:InChI=1/C16H8O2/c17-15-11-7-3-1-5-9(11)13-14(15)10-6-2-4-8-12(10)16(13)18/h1-8H