16650-37-6 Usage
Description
Bicyclo[3.1.0]hexane-6-carboxylic acid is a unique organic compound characterized by its bicyclic structure and carboxylic acid functional group. It possesses versatile chemical properties that make it a valuable building block in organic synthesis and a potential candidate for various applications in different industries.
Uses
Used in Pharmaceutical Industry:
Bicyclo[3.1.0]hexane-6-carboxylic acid is used as a key intermediate in the synthesis of cyclopropane-containing compounds. These compounds have demonstrated their potential as latent irreversible inhibitors of lactate dehydrogenase and alcohol dehydrogenase, which are essential enzymes involved in various metabolic pathways. By targeting these enzymes, cyclopropane-containing compounds can modulate cellular processes and exhibit therapeutic effects in treating specific diseases.
Used in Chemical Synthesis:
Bicyclo[3.1.0]hexane-6-carboxylic acid serves as a versatile building block in the synthesis of various organic compounds. Its unique bicyclic structure and carboxylic acid group allow for a wide range of chemical reactions, enabling the formation of diverse molecular architectures. This makes it a valuable component in the development of new pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Material Science:
The unique structural features of bicyclo[3.1.0]hexane-6-carboxylic acid also make it a promising candidate for the development of novel materials with specific properties. Its incorporation into polymers, for instance, can lead to the creation of materials with improved mechanical strength, thermal stability, or other desirable characteristics. This can have applications in various industries, such as automotive, aerospace, and electronics.
Check Digit Verification of cas no
The CAS Registry Mumber 16650-37-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,6,5 and 0 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 16650-37:
(7*1)+(6*6)+(5*6)+(4*5)+(3*0)+(2*3)+(1*7)=106
106 % 10 = 6
So 16650-37-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H10O2/c8-7(9)6-4-2-1-3-5(4)6/h4-6H,1-3H2,(H,8,9)
16650-37-6Relevant articles and documents
Fused cycloalkyl amides and acids and their therapeutic applications
-
, (2008/06/13)
The present invention relates to the use of compounds of formula (I) for the treatment of epilepsy, bipolar disorder, psychiatric disorders, migraine, pain, or movement disorders, and to provide neuroprotection.
