16690-44-1 Usage
General Description
N-(7-Methoxy-9H-fluoren-2-yl)acetamide is a chemical compound with the molecular formula C16H15NO2. It belongs to the amide functional group, containing a fluorene moiety with a methoxy group attached at the 7-position. N-(7-Methoxy-9H-fluoren-2-yl)acetamide is often used in organic synthesis and medicinal chemistry as a building block for more complex molecules. Its unique structure and properties make it suitable for various applications in the pharmaceutical and materials science industries. Additionally, its amide functional group gives it potential biological activity, making it a valuable compound for research and development in drug discovery and design.
Check Digit Verification of cas no
The CAS Registry Mumber 16690-44-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,6,9 and 0 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 16690-44:
(7*1)+(6*6)+(5*6)+(4*9)+(3*0)+(2*4)+(1*4)=121
121 % 10 = 1
So 16690-44-1 is a valid CAS Registry Number.
InChI:InChI=1/C16H15NO2/c1-10(18)17-13-3-5-15-11(8-13)7-12-9-14(19-2)4-6-16(12)15/h3-6,8-9H,7H2,1-2H3,(H,17,18)