16754-78-2 Usage
Description
[3,4-diacetyloxy-5-(5-oxo-2,4,9-triazabicyclo[4.3.0]nona-3,7,10-trien-9-yl)oxolan-2-yl]methyl acetate is a complex chemical compound with a unique structure. It features multiple functional groups such as acetyl, oxolan, and acetate, which are connected to a central triazabicyclo compound. [3,4-diacetyloxy-5-(5-oxo-2,4,9-triazabicyclo[4.3.0]nona-3,7,10-trien-9-yl)oxolan-2-yl]methyl acetate is likely synthesized for research or pharmaceutical purposes, and may possess biological activity or potential for use in drug development. Its specific properties and potential applications would be of interest to chemists, pharmacologists, and other scientists working in related fields.
Uses
Used in Pharmaceutical Research:
[3,4-diacetyloxy-5-(5-oxo-2,4,9-triazabicyclo[4.3.0]nona-3,7,10-trien-9-yl)oxolan-2-yl]methyl acetate is used as a research compound for its potential biological activity and possible applications in drug development. Its unique structure and functional groups may offer new insights into the design of novel therapeutic agents.
Used in Chemical Synthesis:
In the field of chemical synthesis, [3,4-diacetyloxy-5-(5-oxo-2,4,9-triazabicyclo[4.3.0]nona-3,7,10-trien-9-yl)oxolan-2-yl]methyl acetate can be used as a starting material or intermediate for the synthesis of other complex molecules. Its versatile structure allows for further functionalization and modification, making it a valuable tool for chemists working on the development of new compounds.
Used in Drug Delivery Systems:
Similar to the application of gallotannin, [3,4-diacetyloxy-5-(5-oxo-2,4,9-triazabicyclo[4.3.0]nona-3,7,10-trien-9-yl)oxolan-2-yl]methyl acetate could potentially be employed in the development of novel drug delivery systems. Its unique structure may allow for improved targeting, bioavailability, and therapeutic outcomes when used in conjunction with various organic and metallic nanoparticles as carriers.
Used in Analytical Chemistry:
[3,4-diacetyloxy-5-(5-oxo-2,4,9-triazabicyclo[4.3.0]nona-3,7,10-trien-9-yl)oxolan-2-yl]methyl acetate's specific properties may also make it useful in analytical chemistry, where it could be employed as a reference material, a standard for calibration, or even as a component in the development of new analytical methods or techniques.
Used in Material Science:
Given its complex structure, [3,4-diacetyloxy-5-(5-oxo-2,4,9-triazabicyclo[4.3.0]nona-3,7,10-trien-9-yl)oxolan-2-yl]methyl acetate may have potential applications in material science, where it could be used to develop new materials with unique properties or to improve existing ones.
Check Digit Verification of cas no
The CAS Registry Mumber 16754-78-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,7,5 and 4 respectively; the second part has 2 digits, 7 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 16754-78:
(7*1)+(6*6)+(5*7)+(4*5)+(3*4)+(2*7)+(1*8)=132
132 % 10 = 2
So 16754-78-2 is a valid CAS Registry Number.
InChI:InChI=1/C17H19N3O8/c1-8(21)25-6-12-13(26-9(2)22)14(27-10(3)23)17(28-12)20-5-4-11-15(20)18-7-19-16(11)24/h4-5,7,12-14,17H,6H2,1-3H3,(H,18,19,24)