16754-86-2 Usage
Description
(2R,4R,5R)-2-(hydroxymethyl)-5-(5-methylsulfanyl-2,4,9-triazabicyclo[4.3.0]nona-2,4,7,10-tetraen-9-yl)oxolane-3,4-diol is a complex organic molecule with a unique structure that features a sugar-like backbone and a tricyclic component containing a sulfur atom. Its stereochemistry is denoted by the (2R,4R,5R) prefix, which indicates the specific configuration of its chiral centers. The presence of the hydroxymethyl group and the oxolane-3,4-diol moiety suggests potential reactivity with other biomolecules, while the tricyclic portion may contribute to specific pharmacological properties. (2R,4R,5R)-2-(hydroxymethyl)-5-(5-methylsulfanyl-2,4,9-triazabicyclo[4.3.0]nona-2,4,7,10-tetraen-9-yl)oxolane-3,4-diol's intricate structure, characterized by both its sugar and tricyclic components, may indicate its potential use in medicinal chemistry or as a synthetic building block.
Uses
Used in Medicinal Chemistry:
(2R,4R,5R)-2-(hydroxymethyl)-5-(5-methylsulfanyl-2,4,9-triazabicyclo[4.3.0]nona-2,4,7,10-tetraen-9-yl)oxolane-3,4-diol is used as a potential pharmaceutical candidate for the development of new drugs due to its unique structure and the presence of functional groups that can interact with biomolecules.
Used in Synthetic Chemistry:
In the field of synthetic chemistry, (2R,4R,5R)-2-(hydroxymethyl)-5-(5-methylsulfanyl-2,4,9-triazabicyclo[4.3.0]nona-2,4,7,10-tetraen-9-yl)oxolane-3,4-diol serves as a valuable building block for the synthesis of more complex molecules with potential applications in various industries, including pharmaceuticals, materials science, and agrochemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 16754-86-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,7,5 and 4 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 16754-86:
(7*1)+(6*6)+(5*7)+(4*5)+(3*4)+(2*8)+(1*6)=132
132 % 10 = 2
So 16754-86-2 is a valid CAS Registry Number.
InChI:InChI=1/C12H15N3O4S/c1-20-11-6-2-3-15(10(6)13-5-14-11)12-9(18)8(17)7(4-16)19-12/h2-3,5,7-9,12,16-18H,4H2,1H3
16754-86-2Relevant articles and documents
Synthesis, cytostatic, antimicrobial, and anti-HCV activity of 6-substituted 7-(het)aryl-7-deazapurine ribonucleosides
Nau?, Petr,Caletková, Olga,Kone?ny, Petr,D?ubák, Petr,Bogdanová, Kate?ina,Kolá?, Milan,Vrbková, Jana,Slavětínská, Lenka,Tlou?t'Ová, Eva,Perlíková, Pavla,Hajdúch, Marián,Hocek, Michal
, p. 1097 - 1110 (2014/03/21)
A series of 80 7-(het)aryl- and 7-ethynyl-7-deazapurine ribonucleosides bearing a methoxy, methylsulfanyl, methylamino, dimethylamino, methyl, or oxo group at position 6, or 2,6-disubstituted derivatives bearing a methyl or amino group at position 2, were