1684-42-0 Usage
Chemical structure
The compound has a complex structure consisting of a 6-chloro-2-methoxyacridin-9-yl)amino component and a diethylaminopropanol component linked by a prop-2-ol bond.
Functional groups
The compound contains several functional groups, including an amine group, an ether group, a chlorine atom, and a diethylamino group.
Salt form
The compound is in the form of a dihydrochloride salt, which means it contains two hydrogen chloride molecules.
Potential drug candidate
Due to its unique structure, the compound has the potential to interact with various biological molecules and processes, making it a potential drug candidate.
Further research needed
More research and testing are required to determine the specific uses and potential benefits of this compound in pharmaceutical applications.
Solubility
The compound's solubility properties are not explicitly mentioned in the material provided, but as a dihydrochloride salt, it is likely to be soluble in water.
Stability
The stability of the compound under various conditions (e.g., temperature, pH, light exposure) is not provided in the material, but it is an important factor to consider for potential pharmaceutical applications.
Synonyms
The compound may have alternative names or synonyms, which can be helpful for searching relevant literature or databases.
Molecular weight
The molecular weight of the compound is not provided in the material, but it can be calculated based on the atomic weights of the constituent elements.
Purity
The purity of the compound is not mentioned, but it is a crucial factor for pharmaceutical applications, as impurities can affect the compound's efficacy and safety.
Check Digit Verification of cas no
The CAS Registry Mumber 1684-42-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,6,8 and 4 respectively; the second part has 2 digits, 4 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 1684-42:
(6*1)+(5*6)+(4*8)+(3*4)+(2*4)+(1*2)=90
90 % 10 = 0
So 1684-42-0 is a valid CAS Registry Number.
InChI:InChI=1/C21H26ClN3O2.2ClH/c1-4-25(5-2)13-15(26)12-23-21-17-8-6-14(22)10-20(17)24-19-9-7-16(27-3)11-18(19)21;;/h6-11,15,26H,4-5,12-13H2,1-3H3,(H,23,24);2*1H