17126-90-8 Usage
Description
2-Ketopimelic acid, also known as oxo dicarboxylic acid, is a pimelic acid derivative carrying a single oxo substituent at the 2nd position. It is an organic compound with potential applications in various industries due to its unique chemical properties.
Uses
Used in Chemical Synthesis:
2-Ketopimelic acid is used as a key intermediate in the synthesis of various organic compounds, including pharmaceuticals, agrochemicals, and specialty chemicals. Its unique structure allows for the formation of complex molecules through chemical reactions, making it a valuable building block in the chemical industry.
Used in Biotechnology:
In the biotechnology field, 2-Ketopimelic acid can be utilized as a precursor for the production of amino acids, vitamins, and other biologically active molecules. Its role in metabolic pathways makes it a potential target for the development of novel bioprocesses and the enhancement of existing ones.
Used in Material Science:
2-Ketopimelic acid can be employed in the development of novel materials with specific properties, such as polymers with tailored characteristics. Its ability to form complexes with other molecules can lead to the creation of materials with improved mechanical, thermal, or electrical properties.
Used in Environmental Applications:
Due to its reactivity and ability to form complexes, 2-Ketopimelic acid can be used in environmental applications, such as the removal of heavy metals from wastewater or the degradation of pollutants. Its potential to interact with various contaminants makes it a promising candidate for green chemistry and environmental remediation processes.
Check Digit Verification of cas no
The CAS Registry Mumber 17126-90-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,7,1,2 and 6 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 17126-90:
(7*1)+(6*7)+(5*1)+(4*2)+(3*6)+(2*9)+(1*0)=98
98 % 10 = 8
So 17126-90-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H10O5/c8-5(7(11)12)3-1-2-4-6(9)10/h1-4H2,(H,9,10)(H,11,12)
17126-90-8Relevant articles and documents
HEXONE GLUCOKINASE INHIBITOR AND USE THEREOF
-
, (2021/12/14)
The present invention relates to the technical field of pharmaceuticals, and in particular to a ketohexokinase inhibitor compound, a pharmaceutically acceptable salt, an ester or a stereoisomer thereof; a pharmaceutical composition and formulation containing the compound, the pharmaceutically acceptable salt, the ester or the stereoisomer thereof; a method for preparing the compound, the pharmaceutically acceptable salt, the ester or the stereoisomer thereof; and use of the compound, the pharmaceutically acceptable salt, the ester or the stereoisomer thereof in the manufacture of a medicament for treating and/or preventing KHK-mediated diseases and related conditions.
Microorganisms and methods for the biosynthesis of adipate, hexamethylenediamine and 6-aminocaproic acid
-
Page/Page column, (2013/03/26)
The invention provides a non-naturally occurring microbial organism having a 6-aminocaproic acid, caprolactam, hexametheylenediamine or levulinic acid pathway. The microbial organism contains at least one exogenous nucleic acid encoding an enzyme in the respective 6-aminocaproic acid, caprolactam, hexametheylenediamine or levulinic acid pathway. The invention additionally provides a method for producing 6-aminocaproic acid, caprolactam, hexametheylenediamine or levulinic acid. The method can include culturing a 6-aminocaproic acid, caprolactam or hexametheylenediamine producing microbial organism, where the microbial organism expresses at least one exogenous nucleic acid encoding a 6-aminocaproic acid, caprolactam, hexametheylenediamine or levulinic acid pathway enzyme in a sufficient amount to produce the respective product, under conditions and for a sufficient period of time to produce 6-aminocaproic acid, caprolactam, hexametheylenediamine or levulinic acid.
