17174-03-7 Usage
General Description
2-[(4,6-Dimethylpyrimidin-2-yl)amino]benzoic acid is a chemical compound with the molecular formula C14H14N4O2. It is a derivative of benzoic acid and contains a pyrimidine ring. It is commonly used as a building block in the synthesis of pharmaceuticals and agrochemicals. The compound is also known for its potential antiviral and antitumor activities, making it a widely studied molecule in the field of medicinal chemistry. Its unique structure and pharmacological properties make it a valuable tool for drug discovery and development.
Check Digit Verification of cas no
The CAS Registry Mumber 17174-03-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,7,1,7 and 4 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 17174-03:
(7*1)+(6*7)+(5*1)+(4*7)+(3*4)+(2*0)+(1*3)=97
97 % 10 = 7
So 17174-03-7 is a valid CAS Registry Number.
InChI:InChI=1/C13H13N3O2/c1-8-7-9(2)15-13(14-8)16-11-6-4-3-5-10(11)12(17)18/h3-7H,1-2H3,(H,17,18)(H,14,15,16)