172798-64-0 Usage
Description
(2S)-2-[[(2S)-2-[(4-butoxybenzoyl)amino]-3-phenyl-propanoyl]amino]-4-methylsulfanyl-butanoic acid, also known as Boc-phenylalanine, is a compound used in peptide synthesis. It is a derivative of phenylalanine, an essential amino acid that the body cannot produce on its own. Boc-phenylalanine is often utilized as a building block in the creation of peptides for various pharmaceutical and biochemical applications. Its chemical structure features a butoxybenzoyl group and a methylsulfanyl group, both of which contribute to its unique properties and potential biological activities. Overall, Boc-phenylalanine plays a crucial role in the development and synthesis of peptides with specific structures and functions.
Uses
Used in Pharmaceutical Industry:
Boc-phenylalanine is used as a building block for the synthesis of peptides with specific structures and functions, which can be employed in the development of new drugs and therapies.
Used in Biochemical Research:
Boc-phenylalanine is used in biochemical research to study the properties and functions of peptides and their interactions with other biomolecules. This can help in understanding the mechanisms of various biological processes and diseases.
Used in Peptide Synthesis:
Boc-phenylalanine is used as a key component in the synthesis of peptides, which can be employed in various applications such as drug development, diagnostics, and therapeutics. Its unique chemical structure allows for the creation of peptides with specific properties and functions.
Check Digit Verification of cas no
The CAS Registry Mumber 172798-64-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,2,7,9 and 8 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 172798-64:
(8*1)+(7*7)+(6*2)+(5*7)+(4*9)+(3*8)+(2*6)+(1*4)=180
180 % 10 = 0
So 172798-64-0 is a valid CAS Registry Number.
InChI:InChI=1/C25H32N2O5S/c1-3-4-15-32-20-12-10-19(11-13-20)23(28)27-22(17-18-8-6-5-7-9-18)24(29)26-21(25(30)31)14-16-33-2/h5-13,21-22H,3-4,14-17H2,1-2H3,(H,26,29)(H,27,28)(H,30,31)/t21-,22-/m0/s1