17303-83-2 Usage
Description
3-FORMYL-2-THIOPHENEBORONIC ACID is an organic compound that serves as a versatile building block in the synthesis of various complex organic molecules. It is characterized by its unique chemical structure, which includes a boronic acid group and a formyl group attached to a thiophene ring. This structure endows it with specific reactivity and properties that make it valuable in the field of organic chemistry.
Uses
Used in Pharmaceutical Industry:
3-FORMYL-2-THIOPHENEBORONIC ACID is used as a reactant for Suzuki-Miyaura cross-coupling reactions, which are widely employed in the synthesis of pharmaceutical compounds. These reactions allow for the formation of carbon-carbon bonds, enabling the creation of diverse and complex molecular structures that can be used as potential drug candidates.
Used in Chemical Synthesis:
In the field of chemical synthesis, 3-FORMYL-2-THIOPHENEBORONIC ACID is used as a reactant for Suzuki-Miyaura cross-coupling reactions. This versatile reaction allows for the formation of carbon-carbon bonds between the boronic acid and various organic halides, leading to the synthesis of a wide range of organic compounds with potential applications in various industries, such as materials science, agrochemistry, and the development of new pharmaceuticals.
Used in Research and Development:
3-FORMYL-2-THIOPHENEBORONIC ACID is also utilized in research and development settings, where it can be employed as a starting material or intermediate in the synthesis of novel compounds with potential applications in various fields. Its unique chemical structure and reactivity make it a valuable tool for exploring new chemical reactions and developing innovative synthetic strategies.
Check Digit Verification of cas no
The CAS Registry Mumber 17303-83-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,7,3,0 and 3 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 17303-83:
(7*1)+(6*7)+(5*3)+(4*0)+(3*3)+(2*8)+(1*3)=92
92 % 10 = 2
So 17303-83-2 is a valid CAS Registry Number.
InChI:InChI=1/C5H5BO3S/c7-3-4-1-2-10-5(4)6(8)9/h1-3,8-9H
