175135-04-3 Usage
Description
6-Chloro-5-fluorobenzimidazole is an organic compound with the molecular formula C7H4ClFN2. It is a derivative of benzimidazole, featuring a chlorine atom at the 6th position and a fluorine atom at the 5th position. 6-CHLORO-5-FLUOROBENZIMIDAZOLE is known for its potential applications in various industries, particularly in pharmaceuticals and agrochemicals, due to its unique chemical properties.
Uses
Used in Pharmaceutical Industry:
6-Chloro-5-fluorobenzimidazole is used as a pharmaceutical intermediate for the development of various drugs. Its presence in the molecular structure can enhance the drug's efficacy and bioavailability. It is particularly utilized in the synthesis of antibiotics, sedatives, and cancer treatment medications. The incorporation of fluorine in the compound contributes to the improved pharmacological properties of the resulting drugs, as several top pharmaceutical drugs contain fluorine.
Used in Agrochemical Industry:
In the agrochemical industry, 6-chloro-5-fluorobenzimidazole serves as a key intermediate in the synthesis of various agrochemical products. Its application in this field is attributed to its ability to enhance the effectiveness of pesticides, herbicides, and other agricultural chemicals. The compound's unique structure allows for the development of more targeted and environmentally friendly agrochemicals, contributing to sustainable agricultural practices.
Check Digit Verification of cas no
The CAS Registry Mumber 175135-04-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,1,3 and 5 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 175135-04:
(8*1)+(7*7)+(6*5)+(5*1)+(4*3)+(3*5)+(2*0)+(1*4)=123
123 % 10 = 3
So 175135-04-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H4ClFN2/c8-4-1-6-7(2-5(4)9)11-3-10-6/h1-3H,(H,10,11)
