175135-11-2 Usage
General Description
2,6-DIBROMO-4-CYCLOHEXYLANILINE is a chemical compound that is characterized by its molecular structure, which includes two bromine atoms and a cyclohexyl group attached to an aniline ring. It is commonly used in various chemical and pharmaceutical applications, including as an intermediate in the synthesis of organic compounds and as a reagent in chemical reactions. 2,6-DIBROMO-4-CYCLOHEXYLANILINE is known for its ability to act as a nucleophilic reagent due to the presence of the amino group, and its bromine atoms make it useful in certain types of organic synthesis. Additionally, it has been studied for its potential biological activity and pharmacological properties, contributing to its relevance in drug development and medicinal chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 175135-11-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,1,3 and 5 respectively; the second part has 2 digits, 1 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 175135-11:
(8*1)+(7*7)+(6*5)+(5*1)+(4*3)+(3*5)+(2*1)+(1*1)=122
122 % 10 = 2
So 175135-11-2 is a valid CAS Registry Number.
InChI:InChI=1/C12H15Br2N/c13-10-6-9(7-11(14)12(10)15)8-4-2-1-3-5-8/h6-8H,1-5,15H2