175136-35-3 Usage
Description
1-(8-BROMO-3,4-DIHYDRO-2H-1,5-BENZODIOXEPIN-7-YL)ETHAN-1-ONE is a chemical compound belonging to the benzodioxepin family, characterized by its molecular formula C14H13BrO3. This ketone derivative features a bromine atom and a unique arrangement of functional groups at the 1-(8-bromo-3,4-dihydro-2H-1,5-benzodioxepin-7-yl)ethan-1-one position. Its potential applications in medicinal chemistry and as a precursor for synthesizing other organic compounds are of interest, although further research and testing are required to determine its specific properties and uses.
Used in Medicinal Chemistry:
1-(8-BROMO-3,4-DIHYDRO-2H-1,5-BENZODIOXEPIN-7-YL)ETHAN-1-ONE is used as a chemical intermediate for the development of new pharmaceuticals, given its unique structure and potential reactivity with other compounds. Its presence in the benzodioxepin family suggests it may possess biological activity that could be harnessed for therapeutic purposes.
Used in Organic Synthesis:
As a building block, 1-(8-BROMO-3,4-DIHYDRO-2H-1,5-BENZODIOXEPIN-7-YL)ETHAN-1-ONE is used in the synthesis of other organic compounds, potentially leading to the creation of novel molecules with various applications across different industries. Its bromine atom and ketone functional group may facilitate reactions that enable the formation of complex organic structures.
Check Digit Verification of cas no
The CAS Registry Mumber 175136-35-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,1,3 and 6 respectively; the second part has 2 digits, 3 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 175136-35:
(8*1)+(7*7)+(6*5)+(5*1)+(4*3)+(3*6)+(2*3)+(1*5)=133
133 % 10 = 3
So 175136-35-3 is a valid CAS Registry Number.
InChI:InChI=1/C11H11BrO3/c1-7(13)8-5-10-11(6-9(8)12)15-4-2-3-14-10/h5-6H,2-4H2,1H3