175136-36-4 Usage
Explanation
The molecular formula represents the number of atoms of each element present in a molecule. In this case, the compound has 17 carbon (C) atoms, 13 hydrogen (H) atoms, 1 bromine (Br) atom, and 3 oxygen (O) atoms.
Explanation
This describes the arrangement of atoms and the type of chemical bonds between them in the compound.
Explanation
A ketone derivative is a compound that contains a carbonyl group (C=O) bonded to two other atoms, typically a carbon and a hydrogen.
Explanation
The bromine atom is part of the benzodioxin ring structure, which is a fused ring system containing two oxygen atoms.
Explanation
The phenylethan-1-one group is a structural component of the compound, consisting of a phenyl ring (a six-membered ring with alternating single and double bonds) attached to an ethanone group (a two-carbon chain with a carbonyl group at one end).
Explanation
Due to its structural features, the compound may have potential uses in the development of pharmaceuticals or other medical applications.
Explanation
The presence of the 2,3-dihydro-1,4-benzodioxin moiety in the compound's structure suggests that it may have biological activity, which could be explored for potential pharmaceutical or industrial applications.
Explanation
More research is required to determine the specific biological activities and potential applications of this compound in the fields of medicine and industry.
Chemical structure
1-(7-Bromo-2,3-dihydro-1,4-benzodioxin-6-yl)-2-phenylethan-1-one
Type of compound
Ketone derivative
Presence of bromine atom
Attached to a benzodioxin ring
Presence of phenylethan-1-one group
Connected to the benzodioxin ring
Potential applications
Pharmacology and medicinal chemistry
Biological activity
Possible due to the 2,3-dihydro-1,4-benzodioxin moiety
Further research needed
To explore potential use in pharmaceuticals or other industrial applications
Check Digit Verification of cas no
The CAS Registry Mumber 175136-36-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,1,3 and 6 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 175136-36:
(8*1)+(7*7)+(6*5)+(5*1)+(4*3)+(3*6)+(2*3)+(1*6)=134
134 % 10 = 4
So 175136-36-4 is a valid CAS Registry Number.
InChI:InChI=1/C16H13BrO3/c17-13-10-16-15(19-6-7-20-16)9-12(13)14(18)8-11-4-2-1-3-5-11/h1-5,9-10H,6-8H2
