175136-39-7 Usage
General Description
(7-Bromo-2,3-dihydro-1,4-benzodioxin-6-yl)(4-chlorophenyl)methanone is a chemical compound with potential use in pharmaceutical research and drug development. It is a benzodioxin derivative with a bromine-substituted ring and a chlorophenyl group attached to a methanone moiety. (7-BROMO-2,3-DIHYDRO-1,4-BENZODIOXIN-6-YL)(4-CHLOROPHENYL)METHANONE is of interest due to its potential pharmacological properties and biological activity, making it a target for further investigation in the field of medicinal chemistry. Its unique structure and specific functional groups make it a valuable building block for the synthesis of novel drug candidates targeting various biological pathways and disease targets. Studies on this compound's pharmacokinetics, pharmacodynamics, and structure-activity relationship are essential for understanding its potential therapeutic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 175136-39-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,1,3 and 6 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 175136-39:
(8*1)+(7*7)+(6*5)+(5*1)+(4*3)+(3*6)+(2*3)+(1*9)=137
137 % 10 = 7
So 175136-39-7 is a valid CAS Registry Number.
InChI:InChI=1/C15H10BrClO3/c16-12-8-14-13(19-5-6-20-14)7-11(12)15(18)9-1-3-10(17)4-2-9/h1-4,7-8H,5-6H2
