175137-39-0 Usage
General Description
3-Amino-2-cyano-5-(4-fluorophenyl)thiophene is a chemical compound that falls under the category of organic compounds, and more specifically, organosulfur compounds. It consists of different elements such as carbon, hydrogen, nitrogen, sulfur and fluorine, arranged to form the specific structure. This chemical has a wide array of potential applications, especially in the field of medicinal chemistry as a building block in the preparation of more complex compounds. Its properties as a highly reactive molecule make it suitable for roles in various chemical syntheses. However, like many chemicals, it should be handled carefully due to potential hazards associated with it.
Check Digit Verification of cas no
The CAS Registry Mumber 175137-39-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,1,3 and 7 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 175137-39:
(8*1)+(7*7)+(6*5)+(5*1)+(4*3)+(3*7)+(2*3)+(1*9)=140
140 % 10 = 0
So 175137-39-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H7FS/c1-6-5-11-9-3-2-7(10)4-8(6)9/h2-5H,1H3