175201-50-0 Usage
General Description
2-(4,5-Dichloro-1H-imidazol-1-yl)ethanethioamide is a chemical compound with the molecular formula C6H6Cl2N4S. It is a thioamide derivative of imidazole and is used in various chemical and pharmaceutical applications. 2-(4,5-DICHLORO-1H-IMIDAZOL-1-YL)ETHANETHIOAMIDE is structurally similar to other imidazole derivatives and has potential uses in medicine as an antifungal or antimicrobial agent. Additionally, it may also have applications in the development of crop protection products. Its properties and potential uses make it an interesting compound for further research and development in various fields of science and industry.
Check Digit Verification of cas no
The CAS Registry Mumber 175201-50-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,0 and 1 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 175201-50:
(8*1)+(7*7)+(6*5)+(5*2)+(4*0)+(3*1)+(2*5)+(1*0)=110
110 % 10 = 0
So 175201-50-0 is a valid CAS Registry Number.
InChI:InChI=1/C5H5Cl2N3S/c6-4-5(7)10(2-9-4)1-3(8)11/h2H,1H2,(H2,8,11)