175201-81-7 Usage
General Description
Methyl 4-cyano-3-(1H-pyrrol-1-yl)thiophene-2-carboxylate is a chemical compound with the molecular formula C14H10N2O2S. It is a member of the thiophene family of compounds and is commonly used in the field of organic chemistry as a building block for the synthesis of various pharmaceuticals, agrochemicals, and materials. It is known for its strong aromatic odor and is often used as a flavoring or fragrance ingredient in the production of various consumer products. Additionally, it has been found to exhibit potential biological activity, making it of interest for further research in pharmacology and medicinal chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 175201-81-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,0 and 1 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 175201-81:
(8*1)+(7*7)+(6*5)+(5*2)+(4*0)+(3*1)+(2*8)+(1*1)=117
117 % 10 = 7
So 175201-81-7 is a valid CAS Registry Number.
InChI:InChI=1/C11H8N2O2S/c1-15-11(14)10-9(8(6-12)7-16-10)13-4-2-3-5-13/h2-5,7H,1H3
