175202-43-4 Usage
General Description
"4-(1,3-Dioxolan-2-yl)benzene-1-carbothioamide" is a chemical compound that consists of a benzene ring with a sulfur-containing group and a dioxolane ring attached to it. It is commonly used in organic synthesis and pharmaceutical research as a potential building block for various drugs and bioactive molecules. The compound has interesting properties due to the presence of the dioxolane ring, which can potentially interact with biological targets. Its thioamide functional group also makes it a valuable precursor for the synthesis of various sulfur-containing compounds. Overall, "4-(1,3-Dioxolan-2-yl)benzene-1-carbothioamide" is a versatile chemical with potential applications in drug discovery and development.
Check Digit Verification of cas no
The CAS Registry Mumber 175202-43-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,0 and 2 respectively; the second part has 2 digits, 4 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 175202-43:
(8*1)+(7*7)+(6*5)+(5*2)+(4*0)+(3*2)+(2*4)+(1*3)=114
114 % 10 = 4
So 175202-43-4 is a valid CAS Registry Number.
InChI:InChI=1/C10H11NO2S/c11-9(14)7-1-3-8(4-2-7)10-12-5-6-13-10/h1-4,10H,5-6H2,(H2,11,14)
