175203-44-8 Usage
General Description
1-CYCLOPROPYL-2,4-DIOXO-1,2,3,4-TETRAHYDROPYRIMIDINE-5-CARBONITRILE is a chemical compound with the molecular formula C8H8N4O2. It is a heterocyclic compound that contains a cyclopropyl group and a dioxo tetrahydropyrimidine ring. This chemical has potential applications in medicine and pharmaceuticals due to its unique structure and properties. Its carbonitrile group makes it a potential precursor for the synthesis of various organic compounds, and its heterocyclic ring can impart specific biological activities. Further research and experimentation may uncover its potential uses in drug development and other industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 175203-44-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,0 and 3 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 175203-44:
(8*1)+(7*7)+(6*5)+(5*2)+(4*0)+(3*3)+(2*4)+(1*4)=118
118 % 10 = 8
So 175203-44-8 is a valid CAS Registry Number.
InChI:InChI=1/C8H7N3O2/c9-3-5-4-11(6-1-2-6)8(13)10-7(5)12/h4,6H,1-2H2,(H,10,12,13)
