17527-79-6 Usage
General Description
Bis(4-mercaptophenyl) ether, also known as BMPE, is a subclass of organosulfur compounds, typically characterized by its presence of mercaptan groups. This chemical compound is known for its advanced applications in the development of advanced functional materials, particularly in synthesizing desirable polymer compounds for electronics. It is generally represented by its molecular formula C12H10O2S2 and has a molar mass of approximately 250.33 g/mol. Its properties like versatility and ability to modify surfaces make it ideal for engineering molecular devices and nanostructures. Furthermore, it's critical in the production of specialty polymers for semiconductor industries, where precise control over the material's composition and structure is required.
Check Digit Verification of cas no
The CAS Registry Mumber 17527-79-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,7,5,2 and 7 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 17527-79:
(7*1)+(6*7)+(5*5)+(4*2)+(3*7)+(2*7)+(1*9)=126
126 % 10 = 6
So 17527-79-6 is a valid CAS Registry Number.
InChI:InChI=1/C12H10OS2/c14-11-5-1-9(2-6-11)13-10-3-7-12(15)8-4-10/h1-8,14-15H
