175277-34-6 Usage
Explanation
The molecular formula represents the number of atoms of each element present in a molecule of the compound.
Explanation
It is a derivative of isoxazole, which is a five-membered heterocyclic compound containing two oxygen atoms.
Explanation
The compound belongs to a class of chemical compounds that have a phenyl group attached to an isoxazole ring.
Explanation
The compound is often used in research and laboratory settings due to its potential pharmacological and biological activities, which are still being explored.
Explanation
The compound may have applications in the development of pharmaceutical drugs due to its structural properties and potential interactions with biological systems.
Explanation
The compound is characterized by an isoxazol-5-yl group (a five-membered ring with two oxygen atoms) attached to an ethanone (a two-carbon ketone) molecule.
Explanation
The compound has two chlorine atoms attached to the phenyl ring, which is a six-carbon aromatic ring.
Explanation
The specific properties and uses of 1-[3-(2,4-Dichlorophenyl)isoxazol-5-yl]ethan-1-one are still being explored and investigated, as it is a relatively new compound with potential applications in various fields.
Derivative of Isoxazole
Yes
Class
Phenylisoxazol compounds
Research and Laboratory Use
Potential pharmacological and biological activities
Pharmaceutical Applications
Possible
Structural Characterization
Isoxazol-5-yl group attached to an ethanone molecule
Presence of Chlorine Atoms
Two chlorine atoms on the phenyl ring
Specific Properties and Uses
Under investigation
Check Digit Verification of cas no
The CAS Registry Mumber 175277-34-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,7 and 7 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 175277-34:
(8*1)+(7*7)+(6*5)+(5*2)+(4*7)+(3*7)+(2*3)+(1*4)=156
156 % 10 = 6
So 175277-34-6 is a valid CAS Registry Number.
InChI:InChI=1/C11H7Cl2NO2/c1-6(15)11-5-10(14-16-11)8-3-2-7(12)4-9(8)13/h2-5H,1H3
