17554-28-8 Usage
General Description
Z-ALA-TYR-OME is a compound consisting of three amino acids: Z-Alanine, Tyrosine, and Ornithine. Z-Alanine is a non-proteinogenic amino acid, which means it is not used in the synthesis of proteins but can still play important roles in cellular metabolism. Tyrosine is a proteinogenic amino acid that is essential for the production of neurotransmitters and hormones in the body. Ornithine is a non-proteinogenic amino acid that is involved in the urea cycle and the synthesis of other important molecules in the body. Together, these three amino acids in Z-ALA-TYR-OME may have various biological functions and potential applications in medicine and biotechnology.
Check Digit Verification of cas no
The CAS Registry Mumber 17554-28-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,7,5,5 and 4 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 17554-28:
(7*1)+(6*7)+(5*5)+(4*5)+(3*4)+(2*2)+(1*8)=118
118 % 10 = 8
So 17554-28-8 is a valid CAS Registry Number.
InChI:InChI=1/C21H24N2O6/c1-14(22-21(27)29-13-16-6-4-3-5-7-16)19(25)23-18(20(26)28-2)12-15-8-10-17(24)11-9-15/h3-11,14,18,24H,12-13H2,1-2H3,(H,22,27)(H,23,25)