176380-53-3 Usage
General Description
N-Fmoc-L-threonol is a chemical compound that consists of a threonine molecule with an Fmoc protecting group attached to the hydroxyl group of the threonine side chain. N-Fmoc-L-threonol is often used in peptide synthesis, where it serves as a building block for the construction of larger peptide molecules. The Fmoc group protects the hydroxyl group of threonine, allowing for specific and controlled reactions during the synthesis process. N-Fmoc-L-threonol is commonly used in laboratory settings for the production of peptides with specific sequences and properties, making it a valuable tool in the field of biochemistry and pharmaceutical research.
Check Digit Verification of cas no
The CAS Registry Mumber 176380-53-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,6,3,8 and 0 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 176380-53:
(8*1)+(7*7)+(6*6)+(5*3)+(4*8)+(3*0)+(2*5)+(1*3)=153
153 % 10 = 3
So 176380-53-3 is a valid CAS Registry Number.
InChI:InChI=1/C19H21NO4/c1-12(22)18(10-21)20-19(23)24-11-17-15-8-4-2-6-13(15)14-7-3-5-9-16(14)17/h2-9,12,17-18,21-22H,10-11H2,1H3,(H,20,23)/t12-,18-/m1/s1