176853-91-1 Usage
Description
2-NITRO-9H-PYRIDO[2,3-B]INDOLE is a heterocyclic compound derived from two heterocyclic amines, 2-Amino-9H-pyrido[2,3-b]indole (AαC) and 2-Amino-3-methyl-9H-pyrido[2,3-b]indole (MeAαC), which are found in humans. It is characterized by its unique chemical structure and potential applications in various fields.
Uses
Used in Pharmaceutical Industry:
2-NITRO-9H-PYRIDO[2,3-B]INDOLE is used as a metabolite in the pharmaceutical industry for its potential role in the development of new drugs and therapies. Its unique chemical structure may offer novel interactions with biological targets, leading to the discovery of new treatments for various diseases.
Used in Chemical Research:
In the field of chemical research, 2-NITRO-9H-PYRIDO[2,3-B]INDOLE serves as a valuable compound for studying the properties and reactivity of heterocyclic amines. Its synthesis and modification can provide insights into the development of new chemical processes and applications.
Used in Environmental Monitoring:
2-NITRO-9H-PYRIDO[2,3-B]INDOLE can be used as a marker compound in environmental monitoring to detect the presence of heterocyclic amines in various samples, such as air, water, and soil. This can help in assessing the exposure risks and implementing appropriate mitigation measures.
Used in Analytical Chemistry:
As a reference compound, 2-NITRO-9H-PYRIDO[2,3-B]INDOLE can be employed in analytical chemistry for the calibration of instruments and the development of new analytical methods. Its unique properties can contribute to the improvement of detection and quantification techniques in various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 176853-91-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,6,8,5 and 3 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 176853-91:
(8*1)+(7*7)+(6*6)+(5*8)+(4*5)+(3*3)+(2*9)+(1*1)=181
181 % 10 = 1
So 176853-91-1 is a valid CAS Registry Number.
InChI:InChI=1/C11H7N3O2/c15-14(16)10-6-5-8-7-3-1-2-4-9(7)12-11(8)13-10/h1-6H,(H,12,13)
