178488-40-9 Usage
Description
(8-METHYLIMIDAZO[1,2-A]PYRIDIN-3-YL)METHANOL, also known as MIP, is a heterocyclic chemical compound with the molecular formula C10H10N2O. It is characterized by the presence of both nitrogen and oxygen atoms in its structure, making it a valuable intermediate in the synthesis of various pharmaceutical compounds and organic molecules. MIP is generally considered to be a stable and relatively non-toxic compound, which contributes to its utility in the field of medicinal chemistry and drug development.
Uses
Used in Pharmaceutical Synthesis:
(8-METHYLIMIDAZO[1,2-A]PYRIDIN-3-YL)METHANOL is used as a building block for the synthesis of various pharmaceutical compounds and organic molecules. Its unique structure and properties make it a valuable component in the development of new drugs and chemicals.
Used in Medicinal Chemistry:
(8-METHYLIMIDAZO[1,2-A]PYRIDIN-3-YL)METHANOL is used as an intermediate in medicinal chemistry for the production of drugs and other chemicals. Its stability and non-toxic nature make it a useful candidate for further research and development in this field.
Used in Drug Development:
(8-METHYLIMIDAZO[1,2-A]PYRIDIN-3-YL)METHANOL is used as a key component in drug development, where its unique structure and properties can be leveraged to create novel therapeutic agents and improve existing ones.
Used in Chemical Research:
(8-METHYLIMIDAZO[1,2-A]PYRIDIN-3-YL)METHANOL is used as a research compound in the field of chemistry, where its properties can be studied and utilized to gain insights into the behavior of similar heterocyclic compounds and their potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 178488-40-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,8,4,8 and 8 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 178488-40:
(8*1)+(7*7)+(6*8)+(5*4)+(4*8)+(3*8)+(2*4)+(1*0)=189
189 % 10 = 9
So 178488-40-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H10N2O/c1-7-3-2-4-11-8(6-12)5-10-9(7)11/h2-5,12H,6H2,1H3
178488-40-9Relevant articles and documents
Synthesis of acyclo-C-nucleosides in the imidazo[1,2-a]pyridine and pyrimidine series as antiviral agents
Gueiffier, Alain,Lhassani, Mohammed,Elhakmaoui, Ahmed,Snoeck, Robert,Andrei, Graciela,Chavignon, Olivier,Teulade, Jean-Claude,Kerbal, Abdelali,Essassi, El Mokhtar,Debouzy, Jean-Claude,Witvrouw, Myriam,Blache, Yves,Balzarini, Jan,De Clercq, Erik,Chapat, Jean-Pierre
, p. 2856 - 2859 (2007/10/03)
The synthesis and the antiviral activities of C-3 acyclic nucleoside analogues of imidazo[1,2-a]pyridine and pyrimidine are reported. From these compounds, 20, 21, 22, 23, 28, and 34 showed a specific activity against cytomegalovirus and/or varicella-zoster virus.
