179729-59-0 Usage
Description
(2R)-5-hydroxy-1,2-dimethyl-4-[(E,4S,6R,8S,9S,10S,11R,12R,13R,14S,15R, 17S,18S,19R,20S,21R,23R,25S,27S,28R,29S,30S,31R)-8,9,11,13,15,17,19,21 ,23,25,27,28,29,30,31-pentadecahydroxy-2,4,6,10,12,14,18,20-octamethyl -32-[(2R,3R,4S,5S,6S)-3,4,5,6-tetrahydroxy-6-[(2R)-2-hydroxyundecyl]ox an-2-yl]dotriacont-2-enoyl]-2H-pyrrol-3-one is a complex organic compound with a unique and intricate structure. It consists of a long chain of carbon atoms with multiple hydroxyl and methyl groups attached, as well as a pyrrol-3-one ring and a tetrahydroxy-undecyl group. This highly specialized molecule requires detailed research and testing to fully understand its properties and potential applications.
Uses
As the provided materials do not specify any particular applications for (2R)-5-hydroxy-1,2-dimethyl-4-[(E,4S,6R,8S,9S,10S,11R,12R,13R,14S,15R, 17S,18S,19R,20S,21R,23R,25S,27S,28R,29S,30S,31R)-8,9,11,13,15,17,19,21 ,23,25,27,28,29,30,31-pentadecahydroxy-2,4,6,10,12,14,18,20-octamethyl -32-[(2R,3R,4S,5S,6S)-3,4,5,6-tetrahydroxy-6-[(2R)-2-hydroxyundecyl]ox an-2-yl]dotriacont-2-enoyl]-2H-pyrrol-3-one, it is not possible to list its uses based on the given information. Further research and testing would be necessary to determine its potential applications across various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 179729-59-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,9,7,2 and 9 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 179729-59:
(8*1)+(7*7)+(6*9)+(5*7)+(4*2)+(3*9)+(2*5)+(1*9)=200
200 % 10 = 0
So 179729-59-0 is a valid CAS Registry Number.
InChI:InChI=1/C62H115NO24/c1-12-13-14-15-16-17-18-19-38(64)28-62(86)60(84)59(83)57(81)47(87-62)27-46(72)56(80)58(82)55(79)45(71)25-40(66)23-39(65)24-41(67)32(5)50(74)33(6)42(68)26-43(69)34(7)51(75)35(8)52(76)36(9)53(77)44(70)22-30(3)20-29(2)21-31(4)49(73)48-54(78)37(10)63(11)61(48)85/h21,29-30,32-47,50-53,55-60,64-72,74-77,79-86H,12-20,22-28H2,1-11H3/b31-21+/t29-,30+,32-,33-,34-,35+,36-,37+,38+,39+,40-,41+,42-,43+,44-,45-,46+,47+,50+,51+,52+,53-,55+,56-,57+,58-,59-,60-,62-/m0/s1