18248-94-7 Usage
Molecular structure
1-ethyl-2-[3-(3-ethyl-3H-benzothiazol-2-ylidene)prop-1-enyl]quinolinium iodide is a quinolinium iodide derivative with a complex molecular structure that contains quinolinium as the core heterocyclic structure, with ethyl and benzothiazolylidene substituents.
Photophysical and optoelectronic properties
The compound exhibits unique photophysical and optoelectronic properties, which make it potentially useful in various applications such as organic electronics, photovoltaics, and light-emitting devices.
Reactivity
The iodide group in the molecule plays an important role in its reactivity and can also influence its biological activity.
Potential applications
Due to its unique properties, the compound has potential for further research and development in the field of organic and materials chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 18248-94-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,8,2,4 and 8 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 18248-94:
(7*1)+(6*8)+(5*2)+(4*4)+(3*8)+(2*9)+(1*4)=127
127 % 10 = 7
So 18248-94-7 is a valid CAS Registry Number.
InChI:InChI=1/C23H23N2S.HI/c1-3-24-19(17-16-18-10-5-6-12-20(18)24)11-9-15-23-25(4-2)21-13-7-8-14-22(21)26-23;/h5-17H,3-4H2,1-2H3;1H/q+1;/p-1