18386-16-8 Usage
Description
3,5-Dinitrotyrosine is a non-proteinogenic L-alpha-amino acid derived from L-tyrosine, a naturally occurring amino acid. It is characterized by the presence of nitro groups at positions 3 and 5 on the phenolic ring, which distinguishes it from the parent compound. This modification results in altered chemical and biological properties, making 3,5-dinitrotyrosine a unique molecule with potential applications in various fields.
Uses
Used in Chemical Synthesis:
3,5-Dinitrotyrosine is used as a key intermediate in the synthesis of various organic compounds and pharmaceuticals. Its unique structure allows for the development of novel chemical entities with potential therapeutic or industrial applications.
Used in Environmental Monitoring:
3,5-Dinitrotyrosine can be used as a biomarker for environmental exposure to nitroaromatic compounds, such as trinitrotoluene (TNT) and dinitrotoluene (DNT). The presence of this modified amino acid in biological samples can indicate exposure to these toxic substances, aiding in the assessment of environmental contamination and potential health risks.
Used in Analytical Chemistry:
3,5-Dinitrotyrosine serves as a valuable analytical standard for the development and validation of analytical methods aimed at detecting and quantifying nitroaromatic compounds in environmental and biological samples. Its distinct chemical properties make it an ideal reference material for improving the accuracy and reliability of these analytical techniques.
Used in Research and Development:
3,5-Dinitrotyrosine is utilized in research settings to study the effects of nitroaromatic compounds on biological systems. Its incorporation into proteins can lead to the formation of stable adducts, which can be used to investigate the mechanisms of protein modification and the resulting biological consequences.
Used in Material Science:
The unique chemical properties of 3,5-dinitrotyrosine make it a candidate for the development of novel materials with specific properties, such as enhanced stability or reactivity. Its potential use in the creation of new polymers, coatings, or other materials could have applications in various industries, including aerospace, automotive, and electronics.
Check Digit Verification of cas no
The CAS Registry Mumber 18386-16-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,8,3,8 and 6 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 18386-16:
(7*1)+(6*8)+(5*3)+(4*8)+(3*6)+(2*1)+(1*6)=128
128 % 10 = 8
So 18386-16-8 is a valid CAS Registry Number.
InChI:InChI=1/C9H9N3O7/c10-5(9(14)15)1-4-2-6(11(16)17)8(13)7(3-4)12(18)19/h2-3,5,13H,1,10H2,(H,14,15)
18386-16-8Relevant articles and documents
Structure-activity studies for α-amino-3-hydroxy-5-methyl-4- isoxazolepropanoic acid receptors: Acidic hydroxyphenylalanines
Hill, Ronald A.,Wallace, Lane J.,Miller, Duane D.,Weinstein, David M.,Shams, Gamal,Tai, Henry,Layer, Richard T.,Willins, David,Uretsky, Norman J.,Danthi, Satyavijayan Narasimhan
, p. 3182 - 3191 (2007/10/03)
Antagonists of α-amino-3-hydroxy-5-methyl-4-isoxazolepropanoic acid (AMPA) receptors may have therapeutic potential as psychotropic agents. A series of mononitro- and dinitro-2- and 3-hydroxyphenylalanines was prepared, and their activity compared with wi
