18450-73-2 Usage
Description
(R,R)-(+)-2,4-dimethylheptan-1-ol is a chiral alcohol with a molecular formula of C9H20O. It is characterized by a seven-carbon chain with two methyl groups and a hydroxyl group attached to the first carbon. (R,R)-(+)-2,4-dimethylheptan-1-ol is known for its fruity, floral odor and is widely utilized in various industries due to its unique properties.
Uses
Used in Pharmaceutical Industry:
(R,R)-(+)-2,4-dimethylheptan-1-ol is used as a chiral building block for the synthesis of various pharmaceuticals. Its unique structure allows for the creation of complex molecules with specific biological activities, making it a valuable component in drug development.
Used in Agrochemical Industry:
In the agrochemical industry, (R,R)-(+)-2,4-dimethylheptan-1-ol serves as a chiral building block for the synthesis of agrochemicals. Its ability to form specific molecular structures contributes to the development of targeted and effective products for agricultural applications.
Used in Fragrance and Flavor Industry:
(R,R)-(+)-2,4-dimethylheptan-1-ol is used as a key component in the production of flavors and fragrances for the cosmetic and food industries. Its fruity, floral odor makes it a desirable ingredient for creating pleasant and appealing scents.
Used in Chemical Processes:
(R,R)-(+)-2,4-dimethylheptan-1-ol is utilized as a solvent in various chemical processes. Its properties allow it to dissolve a wide range of substances, making it a versatile and useful compound in the chemical industry.
Used in Synthesis of Other Organic Compounds:
(R,R)-(+)-2,4-dimethylheptan-1-ol also serves as an intermediate in the synthesis of other organic compounds. Its unique structure and functional groups enable the creation of a diverse array of molecules for various applications across different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 18450-73-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,8,4,5 and 0 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 18450-73:
(7*1)+(6*8)+(5*4)+(4*5)+(3*0)+(2*7)+(1*3)=112
112 % 10 = 2
So 18450-73-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H20O/c1-4-5-8(2)6-9(3)7-10/h8-10H,4-7H2,1-3H3/t8-,9-/m1/s1
18450-73-2Relevant articles and documents
Synthesis of (2R,4R)-supellapyrone, the sex pheromone of the brownbanded cockroach, Supella longipalpa, and its three stereoisomers
Fujita, Ken,Mori, Kenji
, p. 493 - 502 (2007/10/03)
Supellapyrone [(2R,4R)-5-(2,4-dimethyl)-3-methyl-2H-pyran-2-one (1)], the female sex pheromone of the brownbanded cockroach (Supella longipalpa), and its three stereoisomers were synthesized by employing lipase-catalyzed desymmetrization or enantiomer separation of syn- or anti-2,4-dimethylpentane-1,5-diol (9) as the key step.
