184901-84-6 Usage
Description
DL-4-HYDROXYMANDELIC ACID MONOHYDRATE is an organic compound that serves as a key intermediate in the synthesis of various pharmaceuticals and chemical products. It is a white crystalline solid and is known for its ability to be used in the creation of enzyme activity-based labeling molecules.
Uses
Used in Pharmaceutical Industry:
DL-4-HYDROXYMANDELIC ACID MONOHYDRATE is used as a synthetic building block for the development of pharmaceutical compounds. Its role in the synthesis of enzyme activity-based labeling molecules makes it a valuable asset in the creation of drugs that can be used for the detection and treatment of various medical conditions.
Used in Chemical Industry:
In the chemical industry, DL-4-HYDROXYMANDELIC ACID MONOHYDRATE is utilized as a starting material for the production of various chemical products. Its versatility in chemical reactions allows it to be a crucial component in the synthesis of a wide range of compounds, contributing to the development of new materials and technologies.
Check Digit Verification of cas no
The CAS Registry Mumber 184901-84-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,8,4,9,0 and 1 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 184901-84:
(8*1)+(7*8)+(6*4)+(5*9)+(4*0)+(3*1)+(2*8)+(1*4)=156
156 % 10 = 6
So 184901-84-6 is a valid CAS Registry Number.
InChI:InChI=1/C8H8O4.H2O/c9-6-3-1-5(2-4-6)7(10)8(11)12;/h1-4,7,9-10H,(H,11,12);1H2/t7-;/m0./s1
