18775-39-8 Usage
Description
1-(5-bromo-7-ethyl-2-benzofuryl)ethan-1-one is a chemical compound characterized by the molecular formula C12H13BrO2. It is a derivative of benzofuran, which is a heterocyclic compound consisting of a benzene ring fused to a furan ring. This specific compound features an ethyl group and a bromine atom attached to the benzofuran ring, along with a ketone group connected to the ethyl chain. Its unique structure and properties render it a valuable component in organic synthesis and medicinal chemistry, where it can be utilized as a versatile building block for the creation of various pharmaceuticals and bioactive compounds. 1-(5-bromo-7-ethyl-2-benzofuryl)ethan-1-one's potential applications in drug discovery and development make it a promising candidate for further research and utilization.
Uses
Used in Pharmaceutical Industry:
1-(5-bromo-7-ethyl-2-benzofuryl)ethan-1-one is used as a building block for the synthesis of various pharmaceuticals and bioactive compounds. Its unique structure allows for the formation of new chemical entities with potential applications in drug discovery and development.
Used in Organic Synthesis:
In the field of organic synthesis, 1-(5-bromo-7-ethyl-2-benzofuryl)ethan-1-one serves as a key intermediate for the preparation of a wide range of chemical compounds. Its versatility in forming different chemical entities makes it a valuable asset in the development of novel molecules with specific properties and functions.
Used in Medicinal Chemistry:
1-(5-bromo-7-ethyl-2-benzofuryl)ethan-1-one is employed in medicinal chemistry as a starting material for the design and synthesis of new drugs. Its structural features enable the creation of compounds with potential therapeutic applications, contributing to the advancement of medical treatments and therapies.
Check Digit Verification of cas no
The CAS Registry Mumber 18775-39-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,8,7,7 and 5 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 18775-39:
(7*1)+(6*8)+(5*7)+(4*7)+(3*5)+(2*3)+(1*9)=148
148 % 10 = 8
So 18775-39-8 is a valid CAS Registry Number.
InChI:InChI=1/C12H11BrO2/c1-3-8-4-10(13)5-9-6-11(7(2)14)15-12(8)9/h4-6H,3H2,1-2H3
