188472-71-1 Usage
Description
4-CHLORO-1-ETHYNYL-2-FLUORO-BENZENE is a halogenated aromatic chemical compound with the molecular formula C8H4ClF. It features a benzene ring with a chlorine atom and a fluorine atom attached, as well as an ethynyl group, which consists of a carbon-carbon triple bond. This unique structure and reactivity make it suitable for various chemical reactions and organic synthesis processes.
Uses
Used in Chemical Synthesis:
4-CHLORO-1-ETHYNYL-2-FLUORO-BENZENE is used as a building block in chemical synthesis for creating a variety of complex organic molecules. Its halogenated nature and ethynyl group provide opportunities for further functionalization and the development of new compounds with specific properties.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 4-CHLORO-1-ETHYNYL-2-FLUORO-BENZENE is used as an intermediate in the synthesis of potential drug candidates. Its unique structure can be leveraged to design molecules with specific biological activities, targeting various therapeutic areas.
Used in Material Science:
4-CHLORO-1-ETHYNYL-2-FLUORO-BENZENE is used as a precursor in the development of novel materials with tailored properties. Its incorporation into polymers or other materials can lead to improved characteristics such as thermal stability, chemical resistance, or specific optical properties.
Further research into the potential applications and properties of 4-CHLORO-1-ETHYNYL-2-FLUORO-BENZENE is ongoing, as its unique structure offers a wide range of possibilities across various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 188472-71-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,8,8,4,7 and 2 respectively; the second part has 2 digits, 7 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 188472-71:
(8*1)+(7*8)+(6*8)+(5*4)+(4*7)+(3*2)+(2*7)+(1*1)=181
181 % 10 = 1
So 188472-71-1 is a valid CAS Registry Number.
InChI:InChI=1/C8H4ClF/c1-2-6-3-4-7(9)5-8(6)10/h1,3-5H
188472-71-1Relevant articles and documents
HETEROCYCLIC GLP-1 AGONISTS
-
, (2022/02/15)
This disclosure relates to GLP-1 agonists of Formula (I), including pharmaceutically acceptable salts and solvates thereof, and pharmaceutical compositions including the same.
