18865-48-0 Usage
Description
ACTINOMYCIN V is a potent antibiotic and antineoplastic agent derived from the Streptomyces bacteria. It is known for its ability to intercalate into DNA and inhibit RNA transcription, making it a valuable compound in the fields of medicine and research.
Uses
Used in Pharmaceutical Industry:
ACTINOMYCIN V is used as an antineoplastic agent for the treatment of various types of cancers, including Wilms' tumor, neuroblastoma, and Ewing's sarcoma. Its mechanism of action involves binding to DNA and inhibiting RNA transcription, leading to the disruption of cellular processes and ultimately cell death.
Used in Research Applications:
ACTINOMYCIN V is used as a research tool to study the specificity and kinetics of certain enzymes, such as 5′-methylthioadenosinephosphorylase (MTAP), which is a tumor suppressor gene expressed enzyme that supports the S-adenosylmethionine (AdoMet) and methionine salvage pathways. Additionally, it is utilized in studies on bacterial quorum sensing pathways that involve enzymes such as 5′-Methylthioadenosine/S-adenosylhomocysteine nucleosidase (MTAN).
Check Digit Verification of cas no
The CAS Registry Mumber 18865-48-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,8,8,6 and 5 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 18865-48:
(7*1)+(6*8)+(5*8)+(4*6)+(3*5)+(2*4)+(1*8)=150
150 % 10 = 0
So 18865-48-0 is a valid CAS Registry Number.
InChI:InChI=1/C62H84N12O17/c1-26(2)42-59(85)73-21-17-18-36(73)57(83)69(13)24-38(76)71(15)48(28(5)6)61(87)89-32(11)44(55(81)65-42)67-53(79)35-20-19-30(9)51-46(35)64-47-40(41(63)50(78)31(10)52(47)91-51)54(80)68-45-33(12)90-62(88)49(29(7)8)72(16)39(77)25-70(14)58(84)37-22-34(75)23-74(37)60(86)43(27(3)4)66-56(45)82/h19-20,26-29,32-33,36-37,42-45,48-49H,17-18,21-25,63H2,1-16H3,(H,65,81)(H,66,82)(H,67,79)(H,68,80)/t32-,33-,36+,37+,42-,43-,44+,45+,48?,49+/m1/s1